Kortykosteron: Różnice pomiędzy wersjami

Dodane 2639 bajtów ,  10 lat temu
poprawa linków do przek., WP:SK, infobox, drobne redakcyjne
(Bot usuwa zbędny szablon {{stub}})
(poprawa linków do przek., WP:SK, infobox, drobne redakcyjne)
{{Związek chemiczny infobox
[[Plik:Corticosterone-2D-skeletal.png|thumb|right|Wzór strukturalny kortykosteronu]]
| Nazwa = Kortykosteron
'''Kortykosteron''' to [[glikokortykoidy|glikokortykoidowy]] [[hormon sterydowy]] (21-węglowy) wydzielany przez [[kora nadnerczy|korę nadnerczy]], wydzielany pod wpływem [[adrenokortykotropina|adrenokortykotropiny]]. Ma zbliżone działanie do [[kortyzol]]u. Wpływa stymulująco na proces [[glukoneogeneza|glukoneogenezy]].
| grafika1 =
 
| grafika1_opis =
| grafika2 =
| grafika2_opis =
| grafika3 = Corticosterone-2D-skeletal.png
| grafika3_opis =
| Nazwa systematyczna = 11β,21-dihydroksypregn-4-eno-3,20-dion
| Inne nazwy = [[numer WE]]: 200-019-6
| Wzór sumaryczny = C<sub>21</sub>H<sub>30</sub>O<sub>4</sub>
| Inne wzory =
| SMILES = CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O
| Masa molowa = 346,46
| Wygląd =
| Numer CAS = {{CAS|50-22-6}}
| PubChem = 5753
| DrugBank =
| Właściwości = ukryj
| Gęstość =
| Stan skupienia w podanej G =
| G warunki niestandardowe =
| Rozpuszczalność w wodzie = 199 mg/l<ref name="ChemIDplus">{{ChemIDplus|50-22-6|data dostępu=2011-01-01}}</ref>
| RwW warunki niestandardowe =
| Inne rozpuszczalniki =
| Temperatura topnienia = 179–183
| Tt warunki niestandardowe =<ref name="Sigma">{{Sigma-Aldrich|27840|SIGMA|data dostępu=2011-01-01}}</ref>
| Temperatura wrzenia =
| Tw warunki niestandardowe =
| Temperatura krytyczna =
| Ciśnienie krytyczne =
| Kwasowość =
| Zasadowość =
| Aktywność optyczna =
| Lepkość =
| L warunki niestandardowe =
| Napięcie powierzchniowe =
| Np warunki niestandardowe =
| Punkt izoelektryczny =
| Typ hybrydyzacji i VSEPR =
| Układ krystalograficzny =
| Moment dipolowy =
| Zewnętrzne dane MSDS = {{Sigma-Aldrich|27840|SIGMA|link=tak}}
| Źródło zagrożeń =<ref name="Sigma" />
| Piktogram = {{Piktogram ostrzegawczy|Xi}}
| Palność =
| Zdrowie =
| Reaktywność =
| Inne =
| Temperatura zapłonu =
| Tz warunki niestandardowe =
| Temperatura samozapłonu =
| Ts warunki niestandardowe =
| Zwroty ryzyka = {{Zwroty R|43}}
| Zwroty bezpieczeństwa = {{Zwroty S|36}}
| Numer RTECS = GM7650000
| Inne aniony =
| Inne kationy =
| Pochodne ? =
| ? =
| Podobne związki =
| aktywny =
| minerał =
}}
'''Kortykosteron''' to [[glikokortykoidyzwiązek organiczny|organiczny]] [[związek chemiczny]], [[Kortykosterydy|glikokortykoidowy]] [[Hormony sterydowe|hormon sterydowy]] (21-węglowy) wydzielany przez [[kora nadnerczy|korę nadnerczy]], wydzielany pod wpływem [[adrenokortykotropinahormon adrenokortykotropowy|adrenokortykotropiny]]. Ma zbliżone działanie do [[kortyzol]]u. Wpływa stymulująco na proces [[glukoneogeneza|glukoneogenezy]].
 
{{Przypisy}}
 
[[Kategoria:Glikokortykosteroidy]]