Kortykosteron: Różnice pomiędzy wersjami

Dodane 325 bajtów ,  9 lat temu
m
regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK
m (r2.7.1) (robot dodaje: sr:Kortikosteron)
m (regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK)
{{Związek chemiczny infobox
| Nazwanazwa = Kortykosteron
|1. grafika1 grafika =
|opis grafika1_opis 1. grafiki =
|2. grafika2 grafika =
|opis grafika2_opis 2. grafiki =
|3. grafika3 grafika = Corticosterone-2D-skeletal.png
|opis grafika3_opis 3. grafiki =
| Nazwanazwa systematyczna = 11β,21-dihydroksypregn-4-eno-3,20-dion
| Inneinne nazwy = [[numer WE]]: 200-019-6
| Wzórwzór sumaryczny = C<sub>21</sub>H<sub>30</sub>O<sub>4</sub>
| Inneinne wzory =
|masa SMILES molowa = CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O346,46
|wygląd Masa molowa = 346,46
| WyglądSMILES = CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O
| Numernumer CAS = {{CAS|50-22-6}}
| PubChem = {{PubChem|5753}}
| DrugBank =
|gęstość Właściwości = ukryj
|gęstość Gęstość źródło =
| Stanstan skupienia w podanej Gg =
| Gg warunki niestandardowe =
| Rozpuszczalnośćrozpuszczalność w wodzie = 199 mg/l<ref name="ChemIDplus">{{ChemIDplus|50-22-6|data dostępu=2011-01-01}}</ref>
| RwWrww warunki niestandardowe =
| Inneinne rozpuszczalniki =
| Temperaturatemperatura topnienia = 179–183
|tt minerał źródło =
| Tttt warunki niestandardowe = <ref name="Sigma">{{Sigma-Aldrich|27840|SIGMA|data dostępu=2011-01-01}}</ref>
| Temperaturatemperatura wrzenia =
| Tw warunki niestandardowe =
|tw źródło Temperatura krytyczna =
| Twtw warunki niestandardowe =
| Ciśnienie krytyczne =
|temperatura Kwasowość krytyczna =
|tk źródło Zasadowość =
|ciśnienie Aktywność optyczna krytyczne =
|ck Lepkość źródło =
|kwasowość Reaktywność =
| L warunki niestandardowe =
|zasadowość =
| Napięcie powierzchniowe =
|aktywność optyczna =
| Np warunki niestandardowe =
|lepkość Punkt izoelektryczny =
|l Typwarunki hybrydyzacji i VSEPRniestandardowe =
|napięcie Układ krystalograficznypowierzchniowe =
| Lnp warunki niestandardowe =
| Moment dipolowy =
|punkt izoelektryczny =
| Zewnętrzne dane MSDS = {{Sigma-Aldrich|27840|SIGMA|link=tak}}
|typ hybrydyzacji i VSEPR =
| Źródło zagrożeń =<ref name="Sigma" />
|układ krystalograficzny =
| Piktogram = {{Piktogram ostrzegawczy|Xi}}
|moment Palność dipolowy =
|moment Zdrowie dipolowy źródło =
| Zewnętrznezewnętrzne dane MSDS = {{Sigma-Aldrich|27840|SIGMA|link=tak}}
| Reaktywność =
|zagrożenia Inne GHS źródło =
|piktogram GHS Temperatura zapłonu =
|hasło GHS =
| Tz warunki niestandardowe =
|zwroty H =
| Temperatura samozapłonu =
|zwroty EUH =
| Ts warunki niestandardowe =
|zwroty ZwrotyP ryzyka = {{Zwroty R|43}} =
|zagrożenia ŹródłoUE zagrożeńźródło = =<ref name="Sigma" />
| Zwroty bezpieczeństwa = {{Zwroty S|36}}
|piktogram NumerUE RTECS = {{Piktogram = GM7650000ostrzegawczy|Xi}}
|zwroty R Inne aniony = {{Zwroty R|43}}
|zwroty S Inne kationy = {{Zwroty S|36}}
|NFPA 704 Pochodne ? =
|NFPA ? 704 źródło =
|temperatura Podobne związki zapłonu =
|tz aktywny źródło =
| Nptz warunki niestandardowe =
| minerał =
| Temperaturatemperatura samozapłonu =
|ts źródło =
| Tzts warunki niestandardowe =
|numer RTECS = GM7650000
|dawka śmiertelna =
|inne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne Moment dipolowyzwiązki =
|commons =
}}
'''Kortykosteron''' – [[związek organiczny|organiczny]] [[związek chemiczny]], [[Kortykosterydy|glikokortykoidowy]] [[Hormony sterydowe|hormon sterydowy]] (21-węglowy) wydzielany przez [[kora nadnerczy|korę nadnerczy]], wydzielany pod wpływem [[hormon adrenokortykotropowy|adrenokortykotropiny]]. Ma zbliżone działanie do [[kortyzol]]u. Wpływa stymulująco na proces [[glukoneogeneza|glukoneogenezy]].
3 255 268

edycji