Kortykosteron: Różnice pomiędzy wersjami

Dodane 9 bajtów ,  6 lat temu
m
aktualizacja wywołania szablonu CAS
(commons, ilustracja)
m (aktualizacja wywołania szablonu CAS)
|wygląd =
|SMILES = CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O
|numer CAS = {{CAS|50-22-6|rok=2013}}
|PubChem = {{PubChem|5753}}
|DrugBank =
1 157 439

edycji