Kortykosteron: Różnice pomiędzy wersjami

Usunięte 63 bajty ,  5 lat temu
Przekształcanie szablonu Szablon:Związek chemiczny infobox
m (aktualizacja wywołania szablonu CAS)
(Przekształcanie szablonu Szablon:Związek chemiczny infobox)
{{Związek chemiczny infobox
|nazwa = Kortykosteron
|1. grafika = Corticosterone-2D-skeletal.png
|opis 1. grafiki =
|2. grafika = Corticosterone-3D-balls.png
|opis 2. grafiki =
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna = 11β,21-dihydroksypregn-4-eno-3,20-dion
|wygląd =
|SMILES = CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O
|numer CAS = {{CAS|50-22-6|rok=2013}}
|PubChem = {{PubChem|5753}}
|DrugBank =
|g warunki niestandardowe =
|rozpuszczalność w wodzie = 199 mg/l<ref name="ChemIDplus">{{ChemIDplus|50-22-6|data dostępu=2011-01-01}}</ref>
|pochodnerww ?źródło =
|rww warunki niestandardowe =
|inne rozpuszczalniki =
|temperatura topnienia = 179–183
|tt źródło = <ref name="Sigma">{{Sigma-Aldrich|27840|SIGMA|data dostępu=2011-01-01}}</ref>
|tt warunki niestandardowe = <ref name="Sigma">{{Sigma-Aldrich|27840|SIGMA|data dostępu=2011-01-01}}</ref>
|temperatura wrzenia =
|tw źródło =
|ciśnienie krytyczne =
|ck źródło =
|? logP =
|kwasowość =
|zasadowość =
|aktywność optyczna =
|lepkość =
|innel źródło kationy =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|np źródło =
|np warunki niestandardowe =
|punkt izoelektryczny =
|typ hybrydyzacji i VSEPR =
|układ krystalograficzny =
|moment dipolowy =
|moment dipolowy źródło =
|zewnętrzne dane MSDSkarta charakterystyki = {{Sigma-Aldrich|27840|SIGMA|link=tak}}
|zagrożenia GHS źródło =
|piktogram GHS =
|numer RTECS = GM7650000
|dawka śmiertelna =
|innepochodne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne związki =
|commons = Category:Corticosterone
}}
'''Kortykosteron''' – [[związek organiczny|organiczny związek chemiczny]], [[Kortykosterydy|glikokortykoidowy]] [[Hormony sterydowe|hormon sterydowy]] (21-węglowy) wydzielany przez [[kora nadnerczy|korę nadnerczy]], wydzielany pod wpływem [[hormon adrenokortykotropowy|adrenokortykotropiny]]. Ma zbliżone działanie do [[kortyzol]]u. Wpływa stymulująco na proces [[glukoneogeneza|glukoneogenezy]].
1 157 439

edycji