Deflazakort: Różnice pomiędzy wersjami

Usunięte 456 bajtów ,  4 lata temu
Przekształcanie szablonu Szablon:Związek chemiczny infobox
m (aktualizacja wywołania szablonu CAS)
(Przekształcanie szablonu Szablon:Związek chemiczny infobox)
|wygląd =
|SMILES = CC1=NC2(C(O1)CC3C2(CC(C4C3CCC5=CC(=O)C=CC45C)O)C)C(=O)COC(=O)C
|numer CAS = {{CAS|14484-47-0|rok=2012}}
|PubChem = {{PubChem|189821}}
|DrugBank =
|kwasowość = 14,33
|zasadowość =
|aktywność optyczna =
|lepkość =
|typl genuźródło =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|receptorynp źródło =
|np warunki niestandardowe =
|punkt izoelektryczny =
|typ hybrydyzacji i VSEPR =
|układ krystalograficzny =
|moment dipolowy =
|moment dipolowy źródło =
|zewnętrzne dane MSDSkarta charakterystyki = {{Sigma-Aldrich|link=tak|SML0123|Sigma}}
|zagrożenia GHS źródło = MSDS
|piktogram GHS = {{Piktogram GHS|brak}}
|numer RTECS = TU4157050
|dawka śmiertelna = LD<sub>50</sub> 5200 mg/kg (mysz, doustnie)
|innepochodne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne związki =
|ATC = [[ATC (H02)|H02 AB13]]
|EC =
|legalność w Polsce =
|stosowanie w ciąży =
|metabolizm =
|wydalanie =
|locus =
|typ genu =
|typ białka =
|receptory =
|wydzielanie =
|transport =
|funkcje =
|antagoniści =
|choroby =
|drogi podawania =
|objętość dystrybucji =
1 013 681

edycji