Transflutryna: Różnice pomiędzy wersjami

Usunięte 60 bajtów ,  4 lata temu
błąd we wzorze sumarycznym
(Przekształcanie szablonu Szablon:Związek chemiczny infobox)
(błąd we wzorze sumarycznym)
|nazwa = Transflutryna
|1. grafika = Transfluthrin.svg
|opis 1. grafiki =
|2. grafika =
|opis 2. grafiki =
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna =
|inne nazwy =
|wzór sumaryczny = C<sub>15</sub>H<sub>12</sub>CCl<sub>l22</sub>F<sub>4</sub>O<sub>2</sub>
|inne wzory =
|masa molowa = 371,15
|wygląd =
|SMILES = CC1([C@@H]([C@H]1C(=O)OCC2=C(C(=CC(=C2F)F)F)F)C=C(Cl)Cl)C
|numer CAS = {{CAS|118712-89-3}}
|PubChem = {{PubChem|656612 }}
|DrugBank = <!--Dalsze przypisy do tej pozycji dodawaj za pomocą tagu<ref name = "DrugBank"/>-->
|gęstość =
|gęstość źródło =
|stan skupienia w podanej g =
|g warunki niestandardowe =
|rozpuszczalność w wodzie =
|rww źródło =
|rww warunki niestandardowe =
|inne rozpuszczalniki =
|temperatura topnienia =
|tt źródło =
|tt warunki niestandardowe =
|temperatura wrzenia =
|tw źródło =
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|logP =
|kwasowość =
|zasadowość =
|lepkość =
|l źródło =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|np źródło =
|np warunki niestandardowe =
|układ krystalograficzny =
|moment dipolowy =
|moment dipolowy źródło =
|karta charakterystyki =
|zagrożenia GHS źródło =
|piktogram GHS =
|hasło GHS =
|zwroty H =
|zwroty EUH =
|zwroty P =
|piktogram UE = {{Piktogram ostrzegawczy|Xi|N}}
|NFPA 704 =
|NFPA 704 źródło =
|temperatura zapłonu =
|tz źródło =
|tz warunki niestandardowe =
|temperatura samozapłonu =
|ts źródło =
|ts warunki niestandardowe =
|numer RTECS =
|dawka śmiertelna =
|pochodne =
|podobne związki =
|commons =
}}
'''Transflutryna''' – szybko działający [[Insektycydy|środek insektobójczy]] o wzorze sumarycznym C<sub>15</sub>H<sub>12</sub>Cl<sub>2</sub>F<sub>4</sub>O<sub>2</sub>. Może być stosowana wewnątrz pomieszczeń przeciwko [[Muchowate|muchom]], [[Komarowate|komarom]] i [[Karaczany|karaczanom]]. Jest substancją stosunkowo lotną (t. topn. 32 °C, t. wrz. 135 °C), działającą kontaktowo i przez [[inhalacja|inhalację]].
8105

edycji