Dichlorodifenylotrichloroetan: Różnice pomiędzy wersjami

Usunięte 975 bajtów ,  4 lata temu
azotoksu nie azotoxu bo linuksa nie linuxa, WP:SK
m (poprawiam przeniesione szablony)
(azotoksu nie azotoxu bo linuksa nie linuxa, WP:SK)
{{Inne znaczenia|pestycydu|[[DDT]] – inne znaczenie tego słowa}}
{{Związek chemiczny infobox
|nazwa = Dichlorodifenylotrichloroetan
|1. grafika = P,p'-dichlorodiphenyltrichloroethane.svg
|opis 1. grafiki =
|2. grafika = DDT-from-xtal-3D-balls.png
|opis 2. grafiki =
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna = 1-chloro-4-[2,2,2-trichloro-1-(4-chlorofenylo)etylo]benzen, 1,1,1-trichloro-2,2-di(4-chlorofenylo)etan
|inne nazwy = dwuchlorodwufenylotrójchloroetan, DDT ([[Międzynarodowa Organizacja Normalizacyjna|ISO]]), ''p,p'''-DDT, klofenotan ([[Międzynarodowa nazwa niezastrzeżona|INN]]), azotoks.
|wzór sumaryczny = C<sub>14</sub>H<sub>9</sub>Cl<sub>5</sub>
|inne wzory =
|masa molowa = 354,49
|wygląd = bezbarwna, krystaliczna substancja albo biały lub prawie biały proszek<ref name="AKRON">{{Akron|8000/6356|data dostępu=2012-07-24}}</ref>
|SMILES = C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C(Cl)(Cl)Cl)Cl
|numer CAS = {{CAS|50-29-3}}
|PubChem = {{PubChem|3036}}
|DrugBank =
|gęstość = 1,556
|gęstość źródło = <ref name="GESTIS">{{GESTIS|ZVG=12510|CAS=50-29-3|data dostępu=2010-08-25}}</ref>
|stan skupienia w podanej g = ciało stałe
|g warunki niestandardowe = 20 °C
|rozpuszczalność w wodzie = 0,0055 mg/l
|rww źródło = {{r|GESTIS|CID}}
|rww warunki niestandardowe =
|inne rozpuszczalniki = słabo w [[etanol]]u, dobrze w [[eter dietylowy|eterze]], [[aceton]]ie, [[benzen]]ie i [[pirydyna|pirydynie]]<ref name="Lide">{{CRC90}}</ref>; rozpuszczalny w tłuszczach i większości rozpuszczalników organicznych
|temperatura topnienia = 107–110
|tt źródło = <ref name="GESTIS" /><ref name="Lide" /><ref name="CID">{{ChemIDplus|50-29-3|data dostępu=2012-07-24}}</ref><ref name="SA">{{Sigma-Aldrich|MSDS=tak|386340|Aldrich}}</ref>{{r|FPX}}
|tt warunki niestandardowe =
|temperatura wrzenia = 260
|tw źródło = <ref name="Lide" />{{r|AKRON|SA}}<ref name="FPX">{{cytuj książkę|nazwisko=Polskie Towarzystwo Farmaceutyczne |tytuł=Farmakopea Polska X|rok=2014 |wydawca=Urząd Rejestracji Produktów Leczniczych, Wyrobów Medycznych i Produktów Biobójczych |miejsce=Warszawa |isbn=978-83-63724-47-7 |strony=4276}}</ref>
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|logP = 6,91{{r|CID}}
|kwasowość =
|zasadowość =
|lepkość =
|l źródło =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|np źródło =
|np warunki niestandardowe =
|układ krystalograficzny =
|moment dipolowy =
|moment dipolowy źródło =
|karta charakterystyki = {{Sigma-Aldrich|link=tak|386340|Aldrich}}
|zagrożenia GHS źródło = {{CLI|18092|CLP=tak|data dostępu=2015-04-10}}
|piktogram GHS = {{Piktogram GHS|06|08|09}}
|hasło GHS = Dgr
|zwroty H = {{Zwroty H|351|301|372|410}}
|zwroty EUH = {{Zwroty EUH|brak}}
|zwroty P = {{Zwroty P|273|281|301+310|314|501}}
|zagrożenia UE źródło = {{CLI|18092|CLP=tak|data dostępu=2015-04-10}}
|piktogram UE = {{Piktogram ostrzegawczy|T|N}}
|zwroty R = {{Zwroty R|25|40|48/25|50/53}}
|zwroty S = {{Zwroty S|1/2|22|36/37|45|60|61}}
|NFPA 704 = {{NFPA 704|zdrowie=2|palność=2|reaktywność=0|inne=}}
|NFPA 704 źródło = <ref>{{Sigma-Aldrich|MSDS=tak|386340|Aldrich|język=en}}</ref>
|temperatura zapłonu = 72–77
|tz źródło = <ref name="GESTIS" />{{r|SA}}
|tz warunki niestandardowe =
|temperatura samozapłonu =
|ts źródło =
|ts warunki niestandardowe =
|numer RTECS = KJ3325000
|dawka śmiertelna = LD<sub>50</sub> 7,6 mg/kg (żaba, doustnie)
|pochodne =
|podobne związki =
|ATC = [[ATC (P03)|P03 AB01]]
|legalność w Polsce =
|stosowanie w ciąży =
|działanie =
|procent wchłaniania =
|biodostępność =
|okres półtrwania =
|wiązanie z białkami osocza =
|metabolizm =
|wydalanie =
|drogi podawania =
|objętość dystrybucji =
|commons = Category:DDT
'''Dichlorodifenylotrichloroetan''' ([[łacina|łac.]] ''Clofenotanum''; '''DDT''', ''Azotox'') – [[Związki organiczne|organiczny związek chemiczny]] z grupy [[Halogenowanie|chlorowanych]] [[węglowodory|węglowodorów]]. Stosowany jako [[Insektycydy|środek owadobójczy]]. Syntezę DDT przeprowadził po raz pierwszy w 1874 [[austria]]cki chemik [[Othmar Zeidler]]. Właściwości owadobójcze tego związku odkrył [[Szwajcaria|Szwajcar]] [[Paul Müller]], za co otrzymał [[Nagroda Nobla|Nagrodę Nobla]] w 1948 r.
== Produkcja w Polsce ==
W Polsce produkcję AzotoxuAzotoksu uruchomiono po II wojnie światowej w 1947 w Zakładach Chemicznych Organika Azot w Jaworznie, a jeden z preparatów zawierających DDT produkowano także w [[Gamrat|Zakładach Chemicznych Gamrat]] w Jaśle<ref>{{cytuj pismo|tytuł=Inwentaryzacja pozostałości TZO w przemyśle|czasopismo=|wydawca=|strony=|url=http://ios.info.pl/gef/doc/GF-POL-INV-R9.PDF}}</ref>.
== Preparaty handlowe ==
Anonimowy użytkownik