Dichlorodifenylotrichloroetan: Różnice pomiędzy wersjami

Usunięte 208 bajtów ,  10 miesięcy temu
drobne redakcyjne, -Akron, źródła/przypisy, drobne merytoryczne
(→‎Historia: Poprawiono gramatykę)
Znaczniki: Z internetu mobilnego Z aplikacji mobilnej Z aplikacji Android
(drobne redakcyjne, -Akron, źródła/przypisy, drobne merytoryczne)
|1. grafika = P,p'-dichlorodiphenyltrichloroethane.svg
|opis 1. grafiki =
|2. grafika = DDT-from-xtal-3D-balls.png
|opis 2. grafiki =
|3. grafika =
|inne wzory =
|masa molowa = 354,49
|wygląd = bezbarwna, krystaliczna substancja albo biały lub prawie biały proszek<ref name="AKRON">{{Akronr|8000/6356|data dostępu=2012-07-24PubChem}}</ref>
|SMILES = C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C(Cl)(Cl)Cl)Cl
|numer CAS = {{CAS|50-29-3}}
|tt warunki niestandardowe =
|temperatura wrzenia = 260
|tw źródło = <ref name="Lide" />{{r|AKRON|SA}}<ref name="FPX">{{cytuj książkę |nazwisko=Polskie Towarzystwo Farmaceutyczne |tytuł=Farmakopea Polska X |rok=2014 |wydawca=Urząd Rejestracji Produktów Leczniczych, Wyrobów Medycznych i Produktów Biobójczych |miejsce=Warszawa |isbn=978-83-63724-47-4 |strony=4276}}</ref>
|tw warunki niestandardowe =
|temperatura krytyczna =
|moment dipolowy =
|moment dipolowy źródło =
|karta charakterystyki = {{Sigma-Aldrich|link=tak|386340|Aldrich|data dostępu=2019-03-28}}
|zagrożenia GHS źródło = {{CLI|18092|CLP=tak|data dostępu=20152019-0403-1028}}
|piktogram GHS = {{Piktogram GHS|06|08|09}}
|hasło GHS = Dgr
|zwroty H = {{Zwroty H|351|301|372|400|410}}
|zwroty EUH = {{Zwroty EUH|brak}}
|zwroty P = {{Zwroty P|273|281280|301+310|314|501}}<ref name=MSDS>{{Sigma-Aldrich|MSDS=tak|386340|Aldrich|data dostępu=2019-03-28}}</ref>
|zagrożenia UE źródło = {{CLI|18092|CLP=tak|data dostępu=2015-04-10}}
|piktogram UE = {{Piktogram ostrzegawczy|T|N}}
|zwroty R = {{Zwroty R|25|40|48/25|50/53}}
|zwroty S = {{Zwroty S|1/2|22|36/37|45|60|61}}
|NFPA 704 = {{NFPA 704|zdrowie=2|palność=2|reaktywność=0|inne=}}
|NFPA 704 źródło = <ref>{{Sigma-Aldrich|MSDS=tak|386340|Aldrich|język=en|data dostępu=2019-03-28}}</ref>
|temperatura zapłonu = 72–77
|tz źródło = <ref name="GESTIS" />{{r|SA}}
|ts warunki niestandardowe =
|numer RTECS = KJ3325000
|dawka śmiertelna = LD<sub>50</sub> 7,687 mg/kg (żabaszczur, doustnie){{r|MSDS}}
|pochodne =
|podobne związki =