Kortykosteron: Różnice pomiędzy wersjami

Usunięte 8 bajtów ,  8 miesięcy temu
m
eliminuje wywołanie CAS z infoboksu
(Poprawiam wywołanie Szablon:ChemIDplus)
m (eliminuje wywołanie CAS z infoboksu)
 
|wygląd =
|SMILES = CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O
|numer CAS = {{CAS|50-22-6}}
|PubChem = 5753
|DrugBank =
1 157 439

edycji