Klopamid: Różnice pomiędzy wersjami

Usunięte 81 bajtów ,  10 lat temu
m
regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK
m (regeneracja szablonu {{Związek chemiczny infobox/aktywny}} + WP:SK)
m (regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK)
{{źródła|data=2010-03}}
{{Związek chemiczny infobox
| Nazwanazwa = Klopamid
|1. grafika1 grafika =
|opis grafika1_opis 1. grafiki =
|2. grafika2 grafika = Clopamide.svg
|opis grafika2_opis 2. grafiki =
|3. grafika3 grafika =
|opis grafika3_opis 3. grafiki =
| Nazwanazwa systematyczna = 4-chloro-''N''-(2,6-dimetylopiperydyn-1-ylo)-3-sulfamoilobenzamid
| Inneinne nazwy =
| Wzórwzór sumaryczny = C<sub>14</sub>H<sub>20</sub>ClN<sub>3</sub>O<sub>3</sub>S
| Inneinne wzory =
|masa SMILES molowa = CC1CCCC(N1NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N)C
|wygląd Masa molowa =
| WyglądSMILES = CC1CCCC(N1NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N)C
| Numernumer CAS = 636-54-4
| PubChem = {{PubChem|2804}}
| DrugBank = <!--Dalsze przypisy do tej pozycji dodawaj za pomocą tagu <ref name = "DrugBank"/>-->
|gęstość Właściwości = ukryj
|gęstość Gęstość źródło =
| Stanstan skupienia w podanej Gg =
| Gg warunki niestandardowe =
| Rozpuszczalnośćrozpuszczalność w wodzie =
| RwWrww warunki niestandardowe =
| Inneinne rozpuszczalniki =
| Temperaturatemperatura topnienia =
|tt minerał źródło =
| Tttt warunki niestandardowe =
| Temperaturatemperatura wrzenia =
| Tw warunki niestandardowe =
|tw źródło Temperatura krytyczna =
| Twtw warunki niestandardowe =
| Ciśnienie krytyczne =
|temperatura Kwasowość krytyczna =
|tk źródło Zasadowość =
|ciśnienie Aktywność optyczna krytyczne =
|ck Lepkość źródło =
|kwasowość =
| L warunki niestandardowe =
|zasadowość =
| Napięcie powierzchniowe =
|aktywność optyczna =
| Np warunki niestandardowe =
|lepkość Punkt izoelektryczny =
|l Typwarunki hybrydyzacji i VSEPRniestandardowe =
|napięcie Układ krystalograficznypowierzchniowe =
| Lnp warunki niestandardowe =
| Moment dipolowy =
|punkt Zewnętrzne dane MSDSizoelektryczny =
|typ hybrydyzacji i VSEPR =
| Źródło zagrożeń = <!-- Wstaw wg wzoru: ((RL|podaj numer CAS związku|data dostępu = )) -->
|układ krystalograficzny =
| Piktogram = <!-- Wstaw symbole wg wzoru: ((Piktogram ostrzegawczy|C|E|F|F+|N|O|T|T+|Xn|Xi|?|brak)) -->
|moment Palność dipolowy =
|moment Zdrowie dipolowy źródło =
|zewnętrzne Reaktywność dane MSDS =
|zagrożenia Inne GHS źródło =
|piktogram GHS Temperatura zapłonu =
|hasło GHS =
| Tz warunki niestandardowe =
|zwroty H =
| Temperatura samozapłonu =
|zwroty EUH =
| Ts warunki niestandardowe =
|zwroty P =
| Zwroty ryzyka = <!-- Wstaw każdy zwrot/zwrot łączony w osobny parametr: ((Zwroty R|xx|yy/zz)) -->
|zagrożenia UE źródło =
| Zwroty bezpieczeństwa = <!-- Wstaw każdy zwrot/zwrot łączony w osobny parametr: ((Zwroty S|xx|yy/zz)) -->
|piktogram Numer RTECS UE =
|zwroty R Inne aniony =
|zwroty S Inne kationy =
|NFPA 704 Pochodne ? =
|NFPA ? 704 źródło =
|temperatura Podobne związki zapłonu =
|tz aktywny źródło = {{Związek chemiczny infobox/aktywny
| Nptz warunki niestandardowe =
| Temperaturatemperatura samozapłonu =
|ts źródło =
| Tzts warunki niestandardowe =
|numer RTECS =
|dawka śmiertelna =
|inne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne Moment dipolowyzwiązki =
|ATC = [[ATC (C03)|C03BA]] 03
|EC =
|stężenie terapeutyczne =
|objętość dystrybucji =
|dawkacommons śmiertelna =
}}
 
| minerał =
}}
 
3 753 974

edycje