Pikrynian amonu: Różnice pomiędzy wersjami

Dodane 90 bajtów ,  10 lat temu
m
regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK
m (robot dodaje: fr:Picrate d'ammonium)
m (regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK)
{{Związek chemiczny infobox
|Nazwanazwa = Pikrynian amonu
|grafika1 1. grafika =
|grafika1_opisopis 1. grafiki =
|grafika2 2. grafika = Pikrynian amonu.png
|grafika2_opisopis 2. grafiki =
|grafika3 3. grafika =
|grafika3_opisopis 3. grafiki =
|Nazwanazwa systematyczna = 2,4,6-trinitrofenolan amonu
|Inneinne nazwy = Explosive D<br />Dunnite
|Wzórwzór sumaryczny = C<sub>6</sub>H<sub>6</sub>N<sub>4</sub>O<sub>7</sub>
|Inneinne wzory =
|Reaktywnośćmasa molowa =
|SMILES = C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].[NH4+]</nowiki>]
|Masawygląd molowa = 246,14
|WyglądSMILES = jasnożółte płatki lub kryształy; gorzki smak
|Numernumer CAS = 131-74-8
|PubChem = 8577
|DrugBank =
|Gęstośćgęstość = 1,6
|Kwasowośćgęstość źródło = =
|Stanstan skupienia w podanej Gg = ciało stałe
|Gg warunki niestandardowe =
|Rozpuszczalność w wodzie = 1 g/100 cm<sup>3</sup>
|rozpuszczalność w wodzie =
|RwWrww warunki niestandardowe =
|Inne rozpuszczalniki =
|Temperaturainne rozpuszczalniki topnienia = 270
|temperatura topnienia =
|Tt warunki niestandardowe = rozkład
|Temperaturatt źródło wrzenia =
|Twtt warunki niestandardowe =
|Temperaturatemperatura wrzenia krytyczna =
|Ciśnienietw źródło krytyczne =
|Tttw warunki niestandardowe = rozkład
|Kwasowość =
|Zasadowośćtemperatura krytyczna = =
|Aktywnośćtk źródło optyczna =
|Lepkośćciśnienie krytyczne = =
|Palność ck źródło =
|L warunki niestandardowe =
|kwasowość =
|Napięcie powierzchniowe =
|zasadowość =
|Np warunki niestandardowe =
|Punktaktywność optyczna izoelektryczny =
|lepkość =
|Typ hybrydyzacji i VSEPR =
|Ll warunki niestandardowe =
|Układ krystalograficzny =
|Napięcienapięcie powierzchniowe =
|Moment dipolowy =
|Npnp warunki niestandardowe =
|Zewnętrzne dane MSDS =
|punkt izoelektryczny =
|Źródło zagrożeń = &nbsp;wg GESTIS<ref name = GESTIS>{{GESTIS|ZVG=|CAS=131-74-8|Data dostępu=2010-09-10}}</ref>
|Typtyp hybrydyzacji i VSEPR =
|Piktogram = {{Piktogram ostrzegawczy|E|T}}
|Układukład krystalograficzny =
|Palność =
|Zdrowiemoment dipolowy = =
|moment dipolowy źródło =
|Reaktywność =
|Innezewnętrzne dane MSDS = =
|Temperatura zapłonuzagrożenia GHS źródło =
|piktogram GHS =
|Tz warunki niestandardowe =
|hasło GHS =
|Temperatura samozapłonu =
|zwroty H =
|Ts warunki niestandardowe =
|Zwrotyzwroty ryzykaEUH = {{Zwroty R|3|23/24/25}} =
|zwroty P =
|Zwroty bezpieczeństwa = {{Zwroty S|1/2|28|35|37|45}}
|Numerzagrożenia RTECSUE źródło = =
|Inne anionypiktogram UE =
|Innezwroty R kationy =
|Pochodnezwroty S ? =
|?NFPA 704 = =
|PodobneNFPA związki704 źródło =
|aktywnytemperatura zapłonu = =
|minerał tz źródło =
|Tztz warunki niestandardowe =
|Temperaturatemperatura samozapłonu =
|ts źródło =
|Tsts warunki niestandardowe =
|numer RTECS =
|dawka śmiertelna =
|inne aniony =
|inne kationy =
|pochodne ? =
|? =
|Momentpodobne dipolowyzwiązki =
|commons =
}}
 
3 747 223

edycje