Klopamid: Różnice pomiędzy wersjami

Dodane 7 bajtów ,  10 lat temu
m
infobox
m (regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK)
m (infobox)
|wzór sumaryczny = C<sub>14</sub>H<sub>20</sub>ClN<sub>3</sub>O<sub>3</sub>S
|inne wzory =
|masa molowa = 345,846
|wygląd =
|SMILES = CC1CCCC(N1NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N)C
1988

edycji