Klopamid: Różnice pomiędzy wersjami

Usunięte 2 bajty ,  10 lat temu
2 miejsca po przecinku - standard, WP:SK
m (infobox)
(2 miejsca po przecinku - standard, WP:SK)
|wzór sumaryczny = C<sub>14</sub>H<sub>20</sub>ClN<sub>3</sub>O<sub>3</sub>S
|inne wzory =
|masa molowa = 345,84685
|wygląd =
|SMILES = CC1CCCC(N1NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N)C
|numer CAS = 636-54-4
|PubChem = {{PubChem|2804}}
|DrugBank = <!--Dalsze przypisy do tej pozycji dodawaj za pomocą tagu <ref name = "DrugBank"/>-->
|gęstość =
|gęstość źródło =