Pikrynian amonu: Różnice pomiędzy wersjami

Dodane 468 bajtów ,  10 lat temu
zagrożenia, źródła/przypisy, drobne redakcyjne, WP:SK
m (WP:SK, infobox)
(zagrożenia, źródła/przypisy, drobne redakcyjne, WP:SK)
|1. grafika =
|opis 1. grafiki =
|2. grafika = Pikrynian amonu.png
|opis 2. grafiki =
|3. grafika = Pikrynian amonu.png
|opis 3. grafiki =
|nazwa systematyczna = 2,4,6-trinitrofenolan amonu
|inne nazwy = ''Explosive D'', ''Dunnite'' <brsmall>([[Stany Zjednoczone|USA]])</small>Dunnite
|wzór sumaryczny = C<sub>6</sub>H<sub>6</sub>N<sub>4</sub>O<sub>7</sub>
|inne wzory =
|SMILES = C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].[NH4+]
|numer CAS = 131-74-8
|PubChem = {{PubChem|8577}}
|DrugBank =
|gęstość = 1,71972
|gęstość źródło = {{r|GESTIS}}
|stan skupienia w podanej g = ciało stałe
|g warunki niestandardowe =
|rozpuszczalność w wodzie = 1011 g/L (20 °C)l
|rww warunki niestandardowe = 20 °C{{r|GESTIS}}
|inne rozpuszczalniki =
|temperatura topnienia = 265
|tt źródło = {{r|GESTIS}}
|tt warunki niestandardowe = rozkład
|temperatura wrzenia =
|tw źródło =
|moment dipolowy źródło =
|zewnętrzne dane MSDS =
|zagrożenia GHS źródło = {{GHS|ZVG=496708|wspólna nazwa=Sole kwasu pikrynowego|data dostępu=2011-06-19}}
|piktogram GHS = {{Piktogram GHS|01|06}}
|hasło GHS = Niebezpieczestwo
|zwroty H = {{Zwroty H|201|301|311|331}}
|zwroty EUH = {{Zwroty EUH|brak}}
|zwroty P = {{Zwroty P|?}}
|zagrożenia UE źródło = {{RL|ZVG=496708|wspólna nazwa=Sole kwasu pikrynowego|data dostępu=2011-06-19}}
|piktogram UE = {{Piktogram ostrzegawczy|E|T}}
|zwroty R = {{Zwroty R|3|23/24/25}}
|zwroty S = {{Zwroty S|1/2|28|35|37|45}}
|NFPA 704 =
|NFPA 704 źródło =
|commons =
}}
'''Pikrynian amonu''' ((NO<sub>2</sub>)<sub>3</sub>C<sub>6</sub>H<sub>2</sub>ONH<sub>4</sub>) - [[związek organiczny|organiczny]] [[związek chemiczny]], [[sole|sól]] [[Kwas pikrynowy|kwasu pikrynowego]] i [[amoniak]]u. Stosowany jako [[materiał wybuchowy]] mało wrażliwy na uderzenia (w przeciwieństwie do [[nitrogliceryna|nitrogliceryny]]), zapalający się od otwartego płomienia (podobnie jak [[proch czarny]]).
 
Używany jest do mieszanin [[pirotechnika|pirotechnicznych]], np.
'''Pikrynian amonu''' ((NO<sub>2</sub>)<sub>3</sub>C<sub>6</sub>H<sub>2</sub>ONH<sub>4</sub>) - [[związek organiczny|organiczny]] [[związek chemiczny]], [[sole|sól]] [[Kwas pikrynowy|kwasu pikrynowego]] i [[amoniak]]u. Stosowany jako [[materiał wybuchowy]] mało wrażliwy na uderzenia (w przeciwieństwie do [[nitrogliceryna|nitrogliceryny]]), zapalający się od otwartego płomienia (podobnie jak [[proch czarny]]).
 
Używany jest do mieszanin [[pirotechnika|pirotechnicznych]], np.
* 72,5% [[azotan(V) amonu|azotanu amonu]] i 27,5% pikrynianu amonu (mieszanina J.M. Czelcowego z końca XIX wieku)
* 57% [[azotan(V) potasu|azotanu potasu]] i 43% pikrynianu amonu (proch pikrynowy)
W [[Stany Zjednoczone|Stanach Zjednoczonych]] w [[1901]] roku wprowadzono go pod nazwą ''Explosive D'' lub ''Dunnite'' i stosowano w pociskach artyleryjskich, ze względu na domniemaną bardzo wysoką odporność na uderzenia. Na początku XX wieku wykazano, że jest on wrażliwszy na uderzenia niż [[trotyl]].
 
{| class="wikitable"
! colspan=2 align="center" | Pikrynian amonu{{r|tabchem}}
! colspan=2 align="center" | Pikrynian amonu<ref name="tabchem">{{Cytuj książkę | nazwisko=Galus | imię=Małgorzata | inni= | tytuł= Tablice chemiczne | data=2008 | wydawca=Wydawnictwo Adamantan | miejsce=Warszawa | isbn=978-83-7350-105-8 | strony=}}</ref>
|-
| '''Rok odkrycia'''
|-
| '''Energia wybuchu'''
| 3,3 MJ/[[Kilogram|kg]]
|-
| '''Zdolność krusząca'''
| 250 cm<sup>3</sup>³ [[Ołów|Pb]] na 10g
|-
| '''Maksimum ciśnienia detonacji'''
|-
| '''Prędkośc detonacji'''
| 7,15 [[Kilometr|km]]/[[s]]
|-
| '''Gęstość odpowiadająca V<sub>det</sub>'''
| 1,70 g/cm<sup>3</sup>³
|-
| '''Temperatura detonacji'''
|-
| '''Objętość produktów gazowych '''
| 680 dm<sup>3</sup>³/kg
|-
| '''Temperatura podczas wybuchu'''
|}
 
{{== Przypisy}} ==
{{Przypisy-lista|1=
* <ref name="GESTIS">{{GESTIS|131-74-8|data dostępu=2011-06-19}}</ref>
!* colspan=2 align="center" | Pikrynian amonu<ref name="tabchem">{{Cytujcytuj książkę | nazwisko=Galus | imię=Małgorzata | inni= | tytuł= Tablice chemiczne | datarok=2008 | wydawca=Wydawnictwo Adamantan | miejsce=Warszawa | isbn=978-83-7350-105-8 | strony=9788373501058}}</ref>
}}
 
[[Kategoria:Pikryniany]]