Azobenzen: Różnice pomiędzy wersjami

Dodane 303 bajty ,  9 lat temu
poprawa linków do przek., WP:SK, drobne merytoryczne, momenty dipolowe, źródła/przypisy
m (r2.7.2+) (Robot dodał fa:آزوبنزن)
(poprawa linków do przek., WP:SK, drobne merytoryczne, momenty dipolowe, źródła/przypisy)
|nazwa = Azobenzen
|1. grafika = Azobenzene.svg
|opis 1. grafiki = izomer ''trans''
|2. grafika = Azobenzene-trans-3D-balls.png
|opis 2. grafiki = izomer ''trans''
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna = difenylodiazen
|inne nazwy = azobenzen
|wygląd = pomarańczowo-czerwone kryształy
|SMILES = C1=CC=C(C=C1)N=NC2=CC=CC=C2
|numer CAS = {{CAS|103-33-3}}</br />17082-12-1 (izomer ''trans'')</br />1080-16-6 (izomer ''cis'')
|PubChem = {{PubChem|2272}}
|DrugBank =
|gęstość = 1,203
|gęstość źródło = {{r|AKRON}}
|g warunki niestandardowe = 20 °C
|rozpuszczalność w wodzie = 6,4 mg/l
|rww warunki niestandardowe =
|inne rozpuszczalniki =
|temperatura topnienia = 65–68
|tt źródło = <ref name="CID">{{ChemIDplus|103-33-3|data dostępu=2012-02-22}}</ref><ref name="SA">{{Sigma-Aldrich|MSDS=tak|424633|Sigma-Aldrich}}</ref>
|tt warunki niestandardowe = izomer ''trans''
|temperatura wrzenia = 293
|tw źródło = {{r|CID|SA}}<ref name="AKRON">{{cytuj stronę |tytuł = Azobenzene |autor = Department of Chemistry, The University of Akron |url = http://ull.chemistry.uakron.edu/erd/Chemicals/10000/8294.html |data dostępu = 2012-02-22 |język = en}}</ref>
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|logP = 3,82
|kwasowość =
|zasadowość = 2,95
|aktywność optyczna =
|lepkość =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|np warunki niestandardowe =
|punkt izoelektryczny =
|typ hybrydyzacji i VSEPR =
|układ krystalograficzny =
|moment dipolowy = izomer trans: 0 D, izomer cis: 3
|moment dipolowy źródło = <ref name="Hartley">{{cytuj pismo|autor=G. S. Hartley, R. J. W. Le Fèvre|tytuł=The dipole moments of cis- and trans-azobenzenes and of some related compounds|czasopismo=J. Chem. Soc.|strony=531-535|data=1939|doi=10.1039/JR9390000531}}</ref>
|moment dipolowy źródło =
|zewnętrzne dane MSDS = {{Sigma-Aldrich|link=tak|424633|Sigma-Aldrich}}
|zagrożenia GHS źródło = {{GHS|103-33-3|data dostępu=2012-02-22}}
|zwroty R = {{Zwroty R|45|20/22|48/22|50/53|68}}
|zwroty S = {{Zwroty S|53|45|60|61}}
|NFPA 704 =
|NFPA 704 źródło =
|temperatura zapłonu = 100
|tz źródło = {{r|SA}}
|temperatura samozapłonu = 477
|ts źródło = {{r|SA}}
|ts warunki niestandardowe =
|numer RTECS = CN1400000
|dawka śmiertelna = LD<sub>50</sub> 1 g/kg (szczur, doustnie)
|inne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne związki = [[anilina]], [[difenyloamina]]
|commons =
}}
'''Azobenzen''', '''difenylodiazen''' – [[związki organiczne|organiczny związek chemiczny]], jeden z aromatycznych [[grupa azowa|związków azowych]].
 
W temperaturze pokojowej tworzy żółte [[kryształCiało krystaliczne|kryształy]]y. Stosowany jest do produkcji barwników organicznych. Należy do związków [[fotochromia|fotochromowych]], występuje w dwóch odmianach [[izomeria geometryczna|izomerycznych ''cis'' i ''trans'']]. Izomer ''trans'' jest bardziej stabilny termodynamicznie od izomeru ''cis''.
[[Plik:Azobenzene isomerization.png|thumb|260px|left|Proces [[fotoizomeryzacja|fotoizomeryzacji]] pod wpływem światła laserowego]]
Oba izomery mogą w siebie wzajemnie przechodzić termicznie lub [[fotochemia|fotochemicznie]] (np. pod wpływem [[nadfiolet]]owego światła [[laser]]owego). Przejście od bardziej stabilnej formy ''trans'' do formy ''cis'' zachodzi pod wpływem fali świetlnej o odpowiedniej długości. Powrotna zmiana [[konformacja|konformacji]] może zajść pod wpływem fali świetlnej o innej [[długość fali|długości fali]] lub w wyniku relaksacji (swobodnego powrotu do bardziej stabilnej formy). Izomery ''cis'' i ''trans'' mają nie tylko różną strukturę, ale także odmienne własności fizyczne i chemiczne, wynikające z odmienności ich budowy.