Fluoresceina: Różnice pomiędzy wersjami

Dodane 5 bajtów ,  6 lat temu
m
WP:CHECK - eliminacja błędu #2 (znacznik nowej linii)
m (WP:CHECK - eliminacja błędu #2 (znacznik nowej linii))
|opis 3. grafiki = roztwór fluoresceiny wkroplony do wody (po lewej) w [[ultrafiolet|świetle UV]] (lampa UV po prawej)
|nazwa systematyczna = 3',6'-dihydroksyspiro[2-benzofurano-3,9'-ksanten]-1-on
|nazwy farmaceutyczne = ''Fluoresceinum,</br />Fluoresceinum natricum''
|inne nazwy =
|wzór sumaryczny = C<sub>20</sub>H<sub>12</sub>O<sub>5</sub>
|wygląd = pomarańczowoczerwony, miałki proszek<ref name="FP8">{{cytuj książkę|nazwisko=Polskie Towarzystwo Farmaceutyczne |tytuł=Farmakopea Polska VIII|rok=2008 |wydawca=Urząd Rejestracji Produktów Leczniczych, Wyrobów Medycznych i Produktów Biobójczych |miejsce=Warszawa |isbn=978-8388157-53-0 |strony=3491}}</ref>
|SMILES = C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
|numer CAS = {{CAS|2321-07-5}}</br />518-47-8 (sól disodowa)</br />13182-27-9 (sól monosodowa)</br />6417-85-2 (sól dipotasowa)
|PubChem = {{PubChem|16850}}
|DrugBank = DB00693
|? =
|podobne związki =
|ATC = [[ATC (S01)|S01 JA01]]</br />[[ATC (S01)|S01 JA51]]
|EC =
|legalność w Polsce =
186 891

edycji