Azobenzen: Różnice pomiędzy wersjami

Dodane 9 bajtów ,  6 lat temu
m
aktualizacja wywołania szablonu CAS
m (aktualizacja wywołania szablonu CAS)
|wygląd = pomarańczowo-czerwone kryształy
|SMILES = C1=CC=C(C=C1)N=NC2=CC=CC=C2
|numer CAS = {{CAS|103-33-3|rok=2012}}<br />17082-12-1 (izomer ''trans'')<br />1080-16-6 (izomer ''cis'')
|PubChem = {{PubChem|2272}}
|DrugBank =
1 171 162

edycje