Fluoresceina: Różnice pomiędzy wersjami

Dodane 9 bajtów ,  6 lat temu
m
aktualizacja wywołania szablonu CAS
m (Wycofano edycje użytkownika 46.171.233.225 (dyskusja). Autor przywróconej wersji to ToBot.)
m (aktualizacja wywołania szablonu CAS)
|wygląd = pomarańczowoczerwony, miałki proszek<ref name="FP8">{{cytuj książkę|nazwisko=Polskie Towarzystwo Farmaceutyczne |tytuł=Farmakopea Polska VIII|rok=2008 |wydawca=Urząd Rejestracji Produktów Leczniczych, Wyrobów Medycznych i Produktów Biobójczych |miejsce=Warszawa |isbn=978-8388157-53-0 |strony=3491}}</ref>
|SMILES = C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
|numer CAS = {{CAS|2321-07-5|rok=2015}}<br />518-47-8 (sól disodowa)<br />13182-27-9 (sól monosodowa)<br />6417-85-2 (sól dipotasowa)
|PubChem = {{PubChem|16850}}
|DrugBank = DB00693
1 171 162

edycje