Azobenzen: Różnice pomiędzy wersjami

Usunięte 55 bajtów ,  6 lat temu
Przekształcanie szablonu Szablon:Związek chemiczny infobox
m (drobne techniczne)
(Przekształcanie szablonu Szablon:Związek chemiczny infobox)
|2. grafika = Azobenzene-trans-3D-balls.png
|opis 2. grafiki = izomer ''trans''
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna = difenylodiazen
|inne nazwy = azobenzen
|wygląd = pomarańczowo-czerwone kryształy
|SMILES = C1=CC=C(C=C1)N=NC2=CC=CC=C2
|numer CAS = {{CAS|103-33-3|rok=2012}}<br />{{CAS|17082-12-1}} (izomer ''trans'')<br />{{CAS|1080-16-6}} (izomer ''cis'')
|PubChem = {{PubChem|2272}}
|DrugBank =
|gęstość = 1,203
|gęstość źródło = {{r|AKRON}}
|g warunki niestandardowe = 20 °C
|rozpuszczalność w wodzie = 6,4 mg/l
|?rww źródło = =
|rww warunki niestandardowe =
|inne rozpuszczalniki =
|temperatura topnienia = 65–68
|tt źródło = <ref name="CID">{{ChemIDplus|103-33-3|data dostępu=2012-02-22}}</ref><ref name="SA">{{Sigma-Aldrich|MSDS=tak|424633|Sigma-Aldrich}}</ref>
|tt warunki niestandardowe = izomer ''trans''
|temperatura wrzenia = 293
|tw źródło = {{r|CID|SA}}<ref name="AKRON">{{cytuj stronę |tytuł = Azobenzene |autor = Department of Chemistry, The University of Akron |url = http://ull.chemistry.uakron.edu/erd/Chemicals/10000/8294.html |data dostępu = 2012-02-22 |język = en}}</ref>
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|logP = 3,82
|kwasowość =
|zasadowość = 2,95
|aktywnośćlepkość optyczna =
|lepkośćl źródło =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|innenp źródło kationy =
|np warunki niestandardowe =
|punkt izoelektryczny =
|typukład hybrydyzacjikrystalograficzny i VSEPR =
|układ krystalograficzny =
|moment dipolowy = izomer trans: 0 D, izomer cis: 3
|moment dipolowy źródło = <ref name="Hartley">{{cytuj pismo|autor=G. S. Hartley, R. J. W. Le Fèvre|tytuł=The dipole moments of cis- and trans-azobenzenes and of some related compounds|czasopismo=J. Chem. Soc.|strony=531-535|data=1939|doi=10.1039/JR9390000531}}</ref>
|zewnętrzne dane MSDSkarta charakterystyki = {{Sigma-Aldrich|link=tak|424633|Sigma-Aldrich}}
|zagrożenia GHS źródło = {{CLI|9850|CLP=tak|data dostępu=2015-04-07}}
|piktogram GHS = {{Piktogram GHS|08|07|09}}
|zwroty R = {{Zwroty R|45|20/22|48/22|50/53|68}}
|zwroty S = {{Zwroty S|53|45|60|61}}
|NFPA 704 =
|NFPA 704 źródło =
|temperatura zapłonu = 100
|tz źródło = {{r|SA}}
|temperatura samozapłonu = 477
|ts źródło = {{r|SA}}
|ts warunki niestandardowe =
|numer RTECS = CN1400000
|dawka śmiertelna = LD<sub>50</sub> 1 g/kg (szczur, doustnie)
|innepochodne aniony = [[sulfasalazyna]]
|inne kationy =
|pochodne ? = [[sulfasalazyna]]
|? =
|podobne związki = [[stylben]], [[difenyloamina]]
|commons =
}}
'''Azobenzen''', '''difenylodiazen''' – [[związki organiczne|organiczny związek chemiczny]], jeden z aromatycznych [[grupa azowa|związków azowych]].
1 171 162

edycje