Fluoresceina: Różnice pomiędzy wersjami

Usunięte 375 bajtów ,  6 lat temu
Przekształcanie szablonu Szablon:Związek chemiczny infobox
(png –––> svg)
(Przekształcanie szablonu Szablon:Związek chemiczny infobox)
|nazwa systematyczna = 3',6'-dihydroksyspiro[2-benzofurano-3,9'-ksanten]-1-on
|nazwy farmaceutyczne = ''Fluoresceinum,<br />Fluoresceinum natricum''
|inne nazwy =
|wzór sumaryczny = C<sub>20</sub>H<sub>12</sub>O<sub>5</sub>
|inne wzory =
|masa molowa = 332,31
|wygląd = pomarańczowoczerwony proszek<ref name="FPX">{{cytuj książkę|nazwisko=Polskie Towarzystwo Farmaceutyczne |tytuł=Farmakopea Polska X|rok=2014 |wydawca=Urząd Rejestracji Produktów Leczniczych, Wyrobów Medycznych i Produktów Biobójczych |miejsce=Warszawa |isbn=978-83-63724-47-7 |strony=4276}}</ref>
|SMILES = C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
|numer CAS = {{CAS|2321-07-5|rok=2015}}<br />{{CAS|518-47-8}} (sól disodowa)<br />{{CAS|13182-27-9}} (sól monosodowa)<br />{{CAS|6417-85-2}} (sól dipotasowa)
|PubChem = {{PubChem|16850}}
|DrugBank = DB00693
|gęstość =
|gęstość źródło =
|stan skupienia w podanej g =
|g warunki niestandardowe =
|rozpuszczalność w wodzie = praktycznie nierozpuszczalna
|rww źródło = {{r|FPX|AKRON}}
|rww warunki niestandardowe =
|inne rozpuszczalniki = '''ciepły [[etanol]]''': rozpuszczalna{{r|FPX}}
|temperatura topnienia = 314–320
|tt źródło = {{r|FPX|DrugBank}}<ref>{{ChemIDplus|2321-07-5|data dostępu=2012-08-21}}</ref><ref name="AKRON">{{Akron|10000/8418|data dostępu=2012-08-21}}</ref><ref name="SA">{{Sigma-Aldrich|MSDS=tak|id= F2456|marka= Aldrich}}</ref>
|tt warunki niestandardowe =
|temperatura wrzenia =
|tw źródło =
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|logP = 3,4
|kwasowość =
|zasadowość =
|aktywnośćlepkość optyczna =
|lepkośćl źródło =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|receptorynp źródło =
|np warunki niestandardowe =
|punkt izoelektryczny =
|typukład hybrydyzacjikrystalograficzny i VSEPR =
|moment dipolowy źródło =
|układ krystalograficzny =
|moment dipolowy źródło = =
|zewnętrzne dane MSDSkarta charakterystyki = {{Sigma-Aldrich|link=tak|id= F2456|marka= Aldrich}}
|moment dipolowy źródło =
|zewnętrzne dane MSDS = {{Sigma-Aldrich|link=tak|id= F2456|marka= Aldrich}}
|zagrożenia GHS źródło = MSDS
|piktogram GHS = {{Piktogram GHS|07}}
|zwroty R = {{Zwroty R|36}}
|zwroty S = {{Zwroty S|26}}
|NFPA 704 =
|NFPA 704 źródło =
|temperatura zapłonu =
|tz źródło =
|tz warunki niestandardowe =
|temperatura samozapłonu =
|ts źródło =
|ts warunki niestandardowe =
|numer RTECS = LM5075000
|dawka śmiertelna = LD<sub>50</sub> 300 mg/kg (mysz, dożylnie)
|innepochodne aniony =
|innepodobne kationyzwiązki = =
|pochodne ? =
|? =
|podobne związki =
|ATC = [[ATC (S01)|S01 JA01]]<br />[[ATC (S01)|S01 JA51]]
|EClegalność w Polsce = =
|legalnośćstosowanie w Polsceciąży =
|stosowanie w ciąży =
|działanie = diagnostyczne
|procent wchłaniania =
|biodostępność =
|okres półtrwania =
|wiązanie z białkami osocza = 85%
|metabolizm =
|wydalanie = z [[mocz]]em
|locus =
|typ genu =
|typ białka =
|receptory =
|wydzielanie =
|transport =
|funkcje =
|antagoniści =
|choroby =
|drogi podawania = dożylnie, miejscowo, dospojówkowo
|objętość dystrybucji = 0,5 l/kg
|commons =
}}
'''Fluoresceina''' – organiczny [[związek chemiczny]], pochodna [[ksanten]]u będąca [[barwniki ksantenowe|barwnikiem ksantenowym]]. W roztworach zasadowych fluoresceina wykazuje zielonożółtą [[fluorescencja|fluorescencję]], widoczną nawet przy rozcieńczeniu jak jeden do kilkudziesięciu milionów. Sól sodowa fluoresceiny zwana jest uraniną lub żółcienią kwasową 73<ref>{{Sigma-Aldrich|id= F6377|marka= SIAL|nazwa= Sól sodowa fluoresceiny}}</ref>.
1 171 162

edycje