Celobioza: Różnice pomiędzy wersjami

Dodane 74 bajty ,  1 rok temu
Zmieniam użycie Szablon:PubChem
(poprawa przek., WP:SK, drobne merytoryczne, źródła/przypisy, drobne redakcyjne, -Akron)
(Zmieniam użycie Szablon:PubChem)
|SMILES = C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O
|numer CAS = {{CAS|528-50-7}}
|PubChem = {{PubChem|10712}}
|DrugBank = DB02061
|gęstość =
{{Przypisy|
<ref name="psc">{{PSChem|strony=66}}</ref>
<ref name="PubChem">{{PubChem|cid=10712|nazwa=D-(+)-Cellobiose|data dostępu=}}</ref>
}}
 
1 169 505

edycji