Pentazocyna: Różnice pomiędzy wersjami

Usunięte 12 bajtów ,  2 lata temu
Zmieniam użycie Szablon:PubChem
[wersja przejrzana][wersja przejrzana]
Nie podano opisu zmian
(Zmieniam użycie Szablon:PubChem)
|SMILES = C[C@H]1[C@H]2CC3=C([C@@]1(CCN2CC=C(C)C)C)C=C(C=C3)O
|numer CAS = {{CAS|359-83-1}}
|PubChem = {{PubChem|441278}}
|DrugBank = APRD01173
|gęstość =
1 293 038

edycji