Fluoresceina: Różnice pomiędzy wersjami

Usunięte 12 bajtów ,  1 rok temu
Zmieniam użycie Szablon:PubChem
(Zmieniam sposób realizacji przypisu używając Szablon:DrugBank)
(Zmieniam użycie Szablon:PubChem)
|SMILES = C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
|numer CAS = {{CAS|2321-07-5}}<br />{{CAS|518-47-8}} (sól disodowa)<br />{{CAS|13182-27-9}} (sól monosodowa)<br />{{CAS|6417-85-2}} (sól dipotasowa)
|PubChem = {{PubChem|16850}}
|DrugBank = DB00693
|gęstość =
1 171 686

edycji