Sulfametoksazol: Różnice pomiędzy wersjami

Usunięte 12 bajtów ,  1 rok temu
Zmieniam użycie Szablon:PubChem
(Zmieniam sposób realizacji przypisu używając Szablon:DrugBank)
(Zmieniam użycie Szablon:PubChem)
|SMILES = CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N
|numer CAS = {{CAS|723-46-6}}
|PubChem = {{PubChem|5329}}
|DrugBank = APRD00076
|gęstość =
1 169 839

edycji