Sulfametoksazol: Różnice pomiędzy wersjami

Dodane 294 bajty ,  1 rok temu
m
drobne techniczne, WP:SK+mSI+ToS+Bn
(Zmieniam użycie Szablon:PubChem)
m (drobne techniczne, WP:SK+mSI+ToS+Bn)
{{Związek chemiczny infobox
|nazwa = Sulfametoksazol
|1. grafika = Sulfamethoxazole-skeletal.svg
|opis 1. grafiki =
|2. grafika =
|opis 2. grafiki =
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna = 4-amino-''N''-(5-metylo-1,2-oksazol-3-ilo)benzenosulfonamid
|inne nazwy =
|wzór sumaryczny = C<sub>10</sub>H<sub>11</sub>N<sub>3</sub>O<sub>3</sub>S
|inne wzory =
|masa molowa = 253,28
|wygląd = żółtobiały proszek{{odn|Lide|2009|s='''3'''-464}}
|SMILES = CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N
|numer CAS = {{CAS|723-46-6}}
|PubChem = 5329
|DrugBank = APRD00076
|gęstość =
|gęstość źródło =
|stan skupienia w podanej g =
|g warunki niestandardowe =
|rozpuszczalność w wodzie = 0,281 g/kg
|rww źródło = {{odn|Lide|2009|s='''8'''-116}}
|rww warunki niestandardowe = 25&nbsp;°C
|2. rozpuszczalność w wodzie = 0,607 g/l
|2. rww źródło = {{r|DB}}
|2. rww warunki niestandardowe = 37&nbsp;°C
|inne rozpuszczalniki = nierozpuszczalny w [[eter dietylowy|eterze dietylowym]]{{odn|Lide|2009|s='''3'''-464}}
|temperatura topnienia = 171
|tt źródło = {{odn|Lide|2009|s='''3'''-464}}
|tt warunki niestandardowe =
|temperatura wrzenia =
|tw źródło =
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|logP = 0,89{{r|DB}}
|kwasowość =
|zasadowość =
|lepkość =
|l źródło =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|np źródło =
|np warunki niestandardowe =
|układ krystalograficzny =
|moment dipolowy =
|moment dipolowy źródło =
|karta charakterystyki = {{Sigma-Aldrich|S7507|FLUKA|link=tak|data dostępu=2015-08-23}}
|zagrożenia GHS źródło = MSDS
|piktogram GHS = {{Piktogram GHS|07}}
|hasło GHS = Uwaga
|zwroty H = {{Zwroty H|315|317|319|335}}
|zwroty EUH = {{Zwroty EUH|brak}}
|zwroty P = {{Zwroty P|280|305+351+338|333+313|337+313}}
|NFPA 704 = {{NFPA 704|0|0|0}}
|NFPA 704 źródło = {{r|SA-US}}
|temperatura zapłonu =
|tz źródło =
|tz warunki niestandardowe =
|temperatura samozapłonu =
|ts źródło =
|ts warunki niestandardowe =
|numer RTECS = WP0700000
|dawka śmiertelna = LD<sub>50</sub> 6200 mg/kg (szczur, doustnie){{r|SA}}
|podobne związki =
|pochodne =
|ATC = [[ATC (J01)|J01EC01]], [[ATC (J04)|J04AM08]]
|legalność w Polsce =
|stosowanie w ciąży =
|działanie =
|procent wchłaniania =
|biodostępność =
|okres półtrwania = 10 h{{r|DB}}
|wiązanie z białkami osocza = 70%{{r|DB}}
|metabolizm = wątrobowy{{r|DB}}
|wydalanie =
|drogi podawania =
|objętość dystrybucji =
|commons = Category:Sulfamethoxazole
}}
'''Sulfametoksazol''' ({{łac.|sulfamethoxazolum}}) – [[związki organiczne|organiczny związek chemiczny]] z grupy [[sulfonamidy|sulfonamidów]], [[lek]] będący [[antybiotyk bakteriostatyczny|antybiotykiem bakteriostatycznym]]. Działa na zasadzie [[inhibicja kompetycyjna|inhibicji kompetycyjnej]] [[syntaza dihydropterynianowa|syntazy dihydropterynianowej]] (poprzez podobieństwo do [[kwas p-aminobenzoesowy|kwasu ''para''-aminobenzoesowego]]), co hamuje u bakterii biosyntezę [[kwas dihydrofoliowy|kwasu dihydrofoliowego]]{{r|DB}}. {{fakt|Jest [[chemioterapeutyk]]iem o średnim czasie działania, podawany w dwóch dawkach na dobę|data=2015-08}}. Łączy się z białkami osocza w 70%{{r|DB}}. {{fakt|Posiada zdolność przenikania do płynu mózgowo-rdzeniowego. Osiąga również wysokie stężenie w moczu|data=2015-08}}. Stosowany łącznie z [[trimetoprimTrimetoprym|trimetoprimem]]em jako preparat złożony – [[kotrimoksazol]].
 
{{fakt|Preparaty dostępne w handlu: Apo-Sulfatrim, Biseptol, Bactrim, Groseptrol, Septrin, Two-Septol|data=2015-08}}.
* <ref name="SA">{{Sigma-Aldrich|S7507|FLUKA|MSDS=tak|data dostępu=2015-08-23}}</ref>
* <ref name="SA-US">{{Sigma-Aldrich|S7507|FLUKA|MSDS=tak|data dostępu=2015-08-23|język=en}}</ref>
* <ref name="DB">{{DrugBank|id=APRD00076DB01015|nazwa=Sulfamethoxazole|data dostępu=}}</ref>
}}