Celobioza: Różnice pomiędzy wersjami

Usunięte 8 bajtów ,  11 miesięcy temu
m
eliminuje wywołanie CAS z infoboksu
(Poprawiam wywołanie Szablon:ChemIDplus)
m (eliminuje wywołanie CAS z infoboksu)
 
|wygląd = białe [[ciało krystaliczne]] w postaci igieł{{r|psc}}
|SMILES = C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O
|numer CAS = {{CAS|528-50-7}}
|PubChem = 10712
|DrugBank = DB02061
1 169 839

edycji