Hioscyjamina: Różnice pomiędzy wersjami

Usunięte 16 bajtów ,  1 rok temu
m
eliminuje wywołanie CAS z infoboksu
(Poprawiam nazwę w Szablon:ChemIDplus)
m (eliminuje wywołanie CAS z infoboksu)
|wygląd =
|SMILES = CN1C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3
|numer CAS = {{CAS|101-31-5}}<br />{{CAS|620-61-1}} (siarczan, [[hydraty|dihydrat]])
|PubChem = 64692
|DrugBank = DB00424
1 172 445

edycji