Pentazocyna: Różnice pomiędzy wersjami

Usunięte 8 bajtów ,  2 lata temu
m
eliminuje wywołanie CAS z infoboksu
[wersja przejrzana][wersja przejrzana]
(Zmieniam użycie Szablon:PubChem)
m (eliminuje wywołanie CAS z infoboksu)
 
|wygląd =
|SMILES = C[C@H]1[C@H]2CC3=C([C@@]1(CCN2CC=C(C)C)C)C=C(C=C3)O
|numer CAS = {{CAS|359-83-1}}
|PubChem = 441278
|DrugBank = APRD01173
1 293 038

edycji