Azobenzen: Różnice pomiędzy wersjami

Usunięte 24 bajty ,  1 rok temu
m
eliminuje wywołanie CAS z infoboksu
(Poprawiam wywołanie Szablon:ChemIDplus)
m (eliminuje wywołanie CAS z infoboksu)
|wygląd = pomarańczowo-czerwone kryształy
|SMILES = C1=CC=C(C=C1)N=NC2=CC=CC=C2
|numer CAS = {{CAS|103-33-3}}<br />{{CAS|17082-12-1}} (izomer ''trans'')<br />{{CAS|1080-16-6}} (izomer ''cis'')
|PubChem = 2272
|DrugBank =
1 171 162

edycje