Kortykosteron: Różnice pomiędzy wersjami

Usunięte 12 bajtów ,  11 miesięcy temu
Zmieniam użycie Szablon:PubChem
(Uzupełnienie dat w szablonie Szablon:Sigma-Aldrich)
(Zmieniam użycie Szablon:PubChem)
|SMILES = CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)C)O
|numer CAS = {{CAS|50-22-6}}
|PubChem = {{PubChem|5753}}
|DrugBank =
|gęstość =
1 157 439

edycji