Pentazocyna: Różnice pomiędzy wersjami

Dodane 9 bajtów ,  7 lat temu
m
aktualizacja wywołania szablonu CAS
[wersja przejrzana][wersja przejrzana]
m (Bot: Przenoszę linki interwiki (10) do Wikidata, są teraz dostępne do edycji na d:q415793)
m (aktualizacja wywołania szablonu CAS)
|wygląd =
|SMILES = C[C@H]1[C@H]2CC3=C([C@@]1(CCN2CC=C(C)C)C)C=C(C=C3)O
|numer CAS = {{CAS|359-83-1|rok=2013}}
|PubChem = {{PubChem|441278}}
|DrugBank = APRD01173
1 293 038

edycji