Celobioza: Różnice pomiędzy wersjami

Usunięte 44 bajty ,  5 lat temu
Przekształcanie szablonu Szablon:Związek chemiczny infobox
m (Bot: Przenoszę 17 linków interwiki do Wikidata, znajdziesz je teraz w zasobie d:q409017)
(Przekształcanie szablonu Szablon:Związek chemiczny infobox)
|nazwa = Celobioza
|1. grafika = Cellobiose skeletal.png
|opis 1. grafiki =
|2. grafika =
|opis 2. grafiki =
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna = (2''R'',3''S'',4''S'',5''R'',6''S'')-2-(hydroksymetylo)-6-[(2''R'',3''S'',4''R'',5''R'',6''R'')-4,5,6-trihydroksy-2-(hydroksymetylo)oksan-3-ylo]oksyoksano-3,4,5-triol
|inne nazwy = 4-''O''-β-<small>D</small>-glukopiranozylo-<small>D</small>-glukoza
|wzór sumaryczny = C<sub>12</sub>H<sub>22</sub>O<sub>11</sub>
|inne wzory =
|masa molowa = 342,30
|wygląd = białe [[ciało krystaliczne]] w postaci igieł{{r|psc}}
|SMILES = C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O
|numer CAS = {{CAS|528-50-7}}
|PubChem = {{PubChem|10712}}
|DrugBank = DB02061
|gęstość źródło = {{r|AKRON}}
|stan skupienia w podanej g = ciało stałe
|g warunki niestandardowe =
|rozpuszczalność w wodzie = 111 g/l
|rww źródło = <ref>{{ChemIDplus|528-50-7|data dostępu=2012-06-17}}</ref>
|temperatura topnienia = 225–230
|tt źródło = <ref name="AKRON">{{Akron|10000/8358|data dostępu=2012-06-17}}</ref>
|tt warunki niestandardowe =
|temperatura wrzenia =
|tw źródło =
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|?logP = =
|kwasowość = 12,39
|zasadowość =
|aktywnośćlepkość optyczna =
|lepkośćl źródło =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|commons np źródło =
|np warunki niestandardowe =
|punkt izoelektryczny =
|typukład hybrydyzacjikrystalograficzny i VSEPR =
|moment dipolowy źródło =
|układ krystalograficzny =
|moment dipolowy źródło = =
|zewnętrzne dane MSDSkarta charakterystyki = {{Sigma-Aldrich|link=tak|22150|Fluka}}
|moment dipolowy źródło =
|zewnętrzne dane MSDS = {{Sigma-Aldrich|link=tak|22150|Fluka}}
|zagrożenia GHS źródło = MSDS
|piktogram GHS = {{Piktogram GHS|brak}}
|hasło GHS =
|zwroty H = {{Zwroty H|brak}}
|zwroty EUH = {{Zwroty EUH|brak}}
|NFPA 704 = {{NFPA 704|zdrowie=1|palność=0|reaktywność=0|inne=}}
|NFPA 704 źródło = {{r|AKRON}}
|temperatura zapłonu =
|tz źródło =
|tz warunki niestandardowe =
|temperatura samozapłonu =
|ts źródło =
|ts warunki niestandardowe =
|numer RTECS =
|dawka śmiertelna =
|innepochodne aniony =
|innepodobne kationyzwiązki = =
|pochodnecommons ? =
|? =
|podobne związki =
|commons =
}}
'''Celobioza''' – [[związek organiczny|organiczny związek chemiczny]], [[disacharydy|dwucukier]], [[dimery|dimer]] [[glukoza|glukozy]], zbudowany z dwóch [[cząsteczka|cząsteczek]] glukozy, połączonych [[wiązanie glikozydowe|wiązaniem β-1,4-glikozydowym]]. Jest jednostką strukturalną [[celuloza|celulozy]] i produktem jej częściowej [[hydroliza|hydrolizy]]{{r|psc}}.
1 169 839

edycji