Deflazakort: Różnice pomiędzy wersjami

Dodane 9 bajtów ,  4 lata temu
m
aktualizacja wywołania szablonu CAS
(Deflazacort structure.svg)
m (aktualizacja wywołania szablonu CAS)
|wygląd =
|SMILES = CC1=NC2(C(O1)CC3C2(CC(C4C3CCC5=CC(=O)C=CC45C)O)C)C(=O)COC(=O)C
|numer CAS = {{CAS|14484-47-0|rok=2012}}
|PubChem = {{PubChem|189821}}
|DrugBank =
1 013 681

edycji