Otwórz menu główne

Zmiany

m
aktualizacja wywołania szablonu CAS
|wygląd = bezbarwna, krystaliczna substancja albo biały lub prawie biały proszek<ref name="AKRON">{{Akron|8000/6356|data dostępu=2012-07-24}}</ref>
|SMILES = C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C(Cl)(Cl)Cl)Cl
|numer CAS = {{CAS|50-29-3|rok=2013}}
|PubChem = {{PubChem|3036}}
|DrugBank =
1 011 147

edycji