Pikrynian amonu: Różnice pomiędzy wersjami

Dodane 48 bajtów ,  10 lat temu
m
WP:SK, infobox
m (regeneracja szablonu {{Związek chemiczny infobox}} + WP:SK)
m (WP:SK, infobox)
{{Związek chemiczny infobox
|nazwa = Pikrynian amonu
|1. grafika =
|opis 1. grafiki =
|2. grafika = Pikrynian amonu.png
|opis 2. grafiki =
|3. grafika =
|opis 3. grafiki =
|nazwa systematyczna = 2,4,6-trinitrofenolan amonu
|inne nazwy = Explosive D<br />Dunnite
|wzór sumaryczny = C<sub>6</sub>H<sub>6</sub>N<sub>4</sub>O<sub>7</sub>
|inne wzory =
|masa molowa = 246,13
|wygląd =
|SMILES = C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].[NH4+]
|numer CAS = 131-74-8
|PubChem = 8577
|DrugBank =
|gęstość = 1,719
|gęstość źródło =
|stan skupienia w podanej g =
|g warunki niestandardowe =
|rozpuszczalność w wodzie = 10 g/L (20 °C)
|rww warunki niestandardowe =
|inne rozpuszczalniki =
|temperatura topnienia =
|tt źródło =
|tt warunki niestandardowe =
|temperatura wrzenia =
|tw źródło =
|tw warunki niestandardowe =
|temperatura krytyczna =
|tk źródło =
|ciśnienie krytyczne =
|ck źródło =
|kwasowość =
|zasadowość =
|aktywność optyczna =
|lepkość =
|l warunki niestandardowe =
|napięcie powierzchniowe =
|np warunki niestandardowe =
|punkt izoelektryczny =
|typ hybrydyzacji i VSEPR =
|układ krystalograficzny =
|moment dipolowy =
|moment dipolowy źródło =
|zewnętrzne dane MSDS =
|zagrożenia GHS źródło =
|piktogram GHS =
|hasło GHS =
|zwroty H =
|zwroty EUH =
|zwroty P =
|zagrożenia UE źródło =
|piktogram UE =
|zwroty R =
|zwroty S =
|NFPA 704 =
|NFPA 704 źródło =
|temperatura zapłonu =
|tz źródło =
|tz warunki niestandardowe =
|temperatura samozapłonu =
|ts źródło =
|ts warunki niestandardowe =
|numer RTECS =
|dawka śmiertelna =
|inne aniony =
|inne kationy =
|pochodne ? =
|? =
|podobne związki =
|commons =
}}
 
 
Używany jest do mieszanin [[pirotechnika|pirotechnicznych]], np.
* 72,5% [[azotan(V) amonu|azotanu amonu]] i 27,5% pikrynianu amonu (mieszanina J.M. Czelcowego z końca XIX wieku)
* 57% [[azotan(V) potasu|azotanu potasu]] i 43% pikrynianu amonu (proch pikrynowy)
* 55% pikrynianu amonu, 25% [[pikrynian potasu|pikrynianu potasu]] i 20% [[dwuchromianDichromian(VI) amonu|dwuchromianudichromianu amonu]] (proch złoty lub złoty pył)
 
W [[Stany Zjednoczone|Stanach Zjednoczonych]] w [[1901]] roku wprowadzono go pod nazwą ''Explosive D'' lub ''Dunnite'' i stosowano w pociskach artyleryjskich, ze względu na domniemaną bardzo wysoką odporność na uderzenia. Na początku XX wieku wykazano, że jest on wrażliwszy na uderzenia niż [[trotyl]].
1988

edycji