Wersja z 14:04, 30 kwi 2012 edytuj Beau.bot (dyskusja \| edycje) 245 936 edycji usunięcie szablonów {{bibliografia start}}, {{bibliografia stop}} ← poprzednia edycja		Wersja z 16:36, 28 sie 2012 edytuj anuluj edycję Mariusz Ch. (dyskusja \| edycje) Redaktorzy 4314 edycji m infobox następna edycja →
Linia 7: \|3. grafika = \|opis 3. grafiki = \|nazwa systematyczna = fosforan β-<small>D</small>-fruktozy \|nazwa systematyczna = fosforan β-<small>D</small>-fruktozy<ref>{{cytuj pismo\|autor=IUPAC Commission on the Nomenclature of Organic Chemistry (CNOC) and IUPAC-IUB Commission on Biochemical Nomenclature (CBN)\|tytuł=Tentative Rules for Carbohydrate Nomenclature. Part 1\|czasopismo=J.Biol.Chem.\|wydanie=3\|wolumin=247\|strony=613-635\|data=1972\|url=http://www.jbc.org/content/247/3/613.full.pdf+html}}</ref> lub fosforan [(2''R'',3''R'',4''S'')-2,3,4,6-tetrahydroksy-5-oksoheksylu]<ref>[http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69507&loc=ec_rcs PubChem Public Chemical Database]</ref> (forma łańcuchowa) \|inne nazwy = fosforan [(2''R'',3''R'',4''S'')-2,3,4,6-tetrahydroksy-5-oksoheksylu] (forma łańcuchowa), β-<small>D</small>-fruktozo-6-fosforan~~<br~~, />fruktozo 6-fosforan~~<br~~, />ester Neuberga \|wzór sumaryczny = C<sub>6</sub>H<sub>13</sub>O<sub>9</sub>P \|inne wzory = \|masa molowa = 262,1514 \|wygląd = \|SMILES = C([C~~@H]~~([C~~@H]~~([C~~@@H]~~(C(=O)CO)O)O)O)OP(=O)(O)O ~~(forma łańcuchowa)<br />OC[C@]1(O)O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O (forma cykliczna)~~ \|numer CAS = {{CAS\|643-13-0}} \|PubChem = {{PubChem\|69507}} \|DrugBank = DB04277 \|gęstość = \|gęstość źródło = Linia 46: \|moment dipolowy = \|moment dipolowy źródło = \|zewnętrzne dane MSDS = {{Sigma-Aldrich\|link=tak\|F1502\|Sigma}} \|zagrożenia GHS źródło = \|postać GHS = \|piktogram GHS = \|hasło GHS = Linia 53 ⟶ 54: \|zwroty EUH = \|zwroty P = \|zagrożenia UE źródło = MSDS \|~~piktogram~~postać UE = sól dipotasowa \|~~zwroty~~piktogram RUE = {{Piktogram = ostrzegawczy\|}} \|zwroty SR = {{Zwroty R\|23/24/25\|36/37/38\|39/23/24/25}} \|zwroty S = {{Zwroty S\|26\|36/37\|45}} \|NFPA 704 = \|NFPA 704 źródło =

Fruktozo-6-fosforan: Różnice pomiędzy wersjami