Sulfametoksazol: Różnice pomiędzy wersjami

Usunięte 8 bajtów ,  11 miesięcy temu
m
eliminuje wywołanie CAS z infoboksu
m (drobne techniczne)
m (eliminuje wywołanie CAS z infoboksu)
 
|wygląd = żółtobiały proszek{{odn|Lide|2009|s='''3'''-464}}
|SMILES = CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N
|numer CAS = {{CAS|723-46-6}}
|PubChem = 5329
|DrugBank = DB01015
1 169 505

edycji